C18H17Cl2N2O3- — CID 7326704
5-[(2,6-dichlorophenyl)methylamino]-2-morpholin-4-ylbenzoate (PubChem CID 7326704) has the molecular formula C18H17Cl2N2O3- and a molecular weight of 380.25 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)methylamino]-2-morpholin-4-ylbenzoate.
| Compound Name | 5-[(2,6-dichlorophenyl)methylamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 7326704 |
| Molecular Formula | C18H17Cl2N2O3- |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)methylamino]-2-morpholin-4-ylbenzoate |
| SMILES | O=C([O-])c1cc(NCc2c(Cl)cccc2Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H18Cl2N2O3/c19-15-2-1-3-16(20)14(15)11-21-12-4-5-17(13(10-12)18(23)24)22-6-8-25-9-7-22/h1-5,10,21H,6-9,11H2,(H,23,24)/p-1 |
| InChIKey | YPRQOUZKCLVUAM-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|