C20H23N2O4- — CID 7011815
5-[(2-ethoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate (PubChem CID 7011815) has the molecular formula C20H23N2O4- and a molecular weight of 355.41 g/mol. Its IUPAC name is 5-[(2-ethoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate.
| Compound Name | 5-[(2-ethoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 7011815 |
| Molecular Formula | C20H23N2O4- |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 5-[(2-ethoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate |
| SMILES | CCOc1ccccc1CNc1ccc(N2CCOCC2)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C20H24N2O4/c1-2-26-19-6-4-3-5-15(19)14-21-16-7-8-18(17(13-16)20(23)24)22-9-11-25-12-10-22/h3-8,13,21H,2,9-12,14H2,1H3,(H,23,24)/p-1 |
| InChIKey | MYMKMBZYSZVYHB-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|