C25H26N2O4 — CID 4727902
2-morpholin-4-yl-5-[(4-phenylmethoxyphenyl)methylamino]benzoic acid (PubChem CID 4727902) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-[(4-phenylmethoxyphenyl)methylamino]benzoic acid.
| Compound Name | 2-morpholin-4-yl-5-[(4-phenylmethoxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 4727902 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-morpholin-4-yl-5-[(4-phenylmethoxyphenyl)methylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccc(OCc3ccccc3)cc2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H26N2O4/c28-25(29)23-16-21(8-11-24(23)27-12-14-30-15-13-27)26-17-19-6-9-22(10-7-19)31-18-20-4-2-1-3-5-20/h1-11,16,26H,12-15,17-18H2,(H,28,29) |
| InChIKey | NFVXUDBCBDZTDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|