C29H27N3O4S — CID 157041395
N-[4-morpholin-4-yl-3-[(4-phenylmethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 157041395) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[4-morpholin-4-yl-3-[(4-phenylmethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-morpholin-4-yl-3-[(4-phenylmethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 157041395 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-[4-morpholin-4-yl-3-[(4-phenylmethoxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(C(=O)Nc2ccc(OCc3ccccc3)cc2)c1)c1cccs1 |
| InChI | InChI=1S/C29H27N3O4S/c33-28(30-22-8-11-24(12-9-22)36-20-21-5-2-1-3-6-21)25-19-23(31-29(34)27-7-4-18-37-27)10-13-26(25)32-14-16-35-17-15-32/h1-13,18-19H,14-17,20H2,(H,30,33)(H,31,34) |
| InChIKey | MBYCMHDQMGUMOG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|