C19H18Cl2N2O4 — CID 2809863
methyl 5-[(2,6-dichlorobenzoyl)amino]-2-morpholin-4-ylbenzoate (PubChem CID 2809863) has the molecular formula C19H18Cl2N2O4 and a molecular weight of 409.27 g/mol. Its IUPAC name is methyl 5-[(2,6-dichlorobenzoyl)amino]-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 5-[(2,6-dichlorobenzoyl)amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 2809863 |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | methyl 5-[(2,6-dichlorobenzoyl)amino]-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2c(Cl)cccc2Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H18Cl2N2O4/c1-26-19(25)13-11-12(5-6-16(13)23-7-9-27-10-8-23)22-18(24)17-14(20)3-2-4-15(17)21/h2-6,11H,7-10H2,1H3,(H,22,24) |
| InChIKey | VRJUUPGXXJOUBR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|