C20H20BrClN2O4 — CID 4907817
ethyl 5-[(5-bromo-2-chlorobenzoyl)amino]-2-morpholin-4-ylbenzoate (PubChem CID 4907817) has the molecular formula C20H20BrClN2O4 and a molecular weight of 467.75 g/mol. Its IUPAC name is ethyl 5-[(5-bromo-2-chlorobenzoyl)amino]-2-morpholin-4-ylbenzoate.
| Compound Name | ethyl 5-[(5-bromo-2-chlorobenzoyl)amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 4907817 |
| Molecular Formula | C20H20BrClN2O4 |
| Molecular Weight | 467.75 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | ethyl 5-[(5-bromo-2-chlorobenzoyl)amino]-2-morpholin-4-ylbenzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cc(Br)ccc2Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H20BrClN2O4/c1-2-28-20(26)16-12-14(4-6-18(16)24-7-9-27-10-8-24)23-19(25)15-11-13(21)3-5-17(15)22/h3-6,11-12H,2,7-10H2,1H3,(H,23,25) |
| InChIKey | VBWAHGXWVKDOLR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|