C17H15BrCl2N2O2 — CID 3540597
5-bromo-2-chloro-N-(3-chloro-4-morpholin-4-ylphenyl)benzamide (PubChem CID 3540597) has the molecular formula C17H15BrCl2N2O2 and a molecular weight of 430.13 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(3-chloro-4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(3-chloro-4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 3540597 |
| Molecular Formula | C17H15BrCl2N2O2 |
| Molecular Weight | 430.13 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 5-bromo-2-chloro-N-(3-chloro-4-morpholin-4-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(Cl)c1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C17H15BrCl2N2O2/c18-11-1-3-14(19)13(9-11)17(23)21-12-2-4-16(15(20)10-12)22-5-7-24-8-6-22/h1-4,9-10H,5-8H2,(H,21,23) |
| InChIKey | DNPSXLLUFSWIAC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.13 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|