C20H20Cl3N3O4S — CID 5295479
2,4-dichloro-N-(3-chloro-4-morpholin-4-ylphenyl)-5-(cyclopropylsulfamoyl)benzamide (PubChem CID 5295479) has the molecular formula C20H20Cl3N3O4S and a molecular weight of 504.82 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-chloro-4-morpholin-4-ylphenyl)-5-(cyclopropylsulfamoyl)benzamide.
| Compound Name | 2,4-dichloro-N-(3-chloro-4-morpholin-4-ylphenyl)-5-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 5295479 |
| Molecular Formula | C20H20Cl3N3O4S |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 2,4-dichloro-N-(3-chloro-4-morpholin-4-ylphenyl)-5-(cyclopropylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(Cl)c1)c1cc(S(=O)(=O)NC2CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl3N3O4S/c21-15-11-17(23)19(31(28,29)25-12-1-2-12)10-14(15)20(27)24-13-3-4-18(16(22)9-13)26-5-7-30-8-6-26/h3-4,9-12,25H,1-2,5-8H2,(H,24,27) |
| InChIKey | YWTMMTCNGJQTKW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|