C16H15BrClN3O2 — CID 1227119
5-bromo-N-(3-chloro-4-morpholin-4-ylphenyl)pyridine-3-carboxamide (PubChem CID 1227119) has the molecular formula C16H15BrClN3O2 and a molecular weight of 396.67 g/mol. Its IUPAC name is 5-bromo-N-(3-chloro-4-morpholin-4-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(3-chloro-4-morpholin-4-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1227119 |
| Molecular Formula | C16H15BrClN3O2 |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 5-bromo-N-(3-chloro-4-morpholin-4-ylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(Cl)c1)c1cncc(Br)c1 |
| InChI | InChI=1S/C16H15BrClN3O2/c17-12-7-11(9-19-10-12)16(22)20-13-1-2-15(14(18)8-13)21-3-5-23-6-4-21/h1-2,7-10H,3-6H2,(H,20,22) |
| InChIKey | VAFCUURZAQEAEL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|