C23H24ClN5O3 — CID 46249483
N-(3-chloro-4-morpholin-4-ylphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide (PubChem CID 46249483) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 46249483 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(Cl)c1)c1nc2ccccc2nc1N1CCOCC1 |
| InChI | InChI=1S/C23H24ClN5O3/c24-17-15-16(5-6-20(17)28-7-11-31-12-8-28)25-23(30)21-22(29-9-13-32-14-10-29)27-19-4-2-1-3-18(19)26-21/h1-6,15H,7-14H2,(H,25,30) |
| InChIKey | REBJNDFQUVSXGL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|