C21H22N4O4 — CID 46365271
N-(2,4-dimethoxyphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide (PubChem CID 46365271) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 46365271 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-morpholin-4-ylquinoxaline-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nc3ccccc3nc2N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C21H22N4O4/c1-27-14-7-8-17(18(13-14)28-2)24-21(26)19-20(25-9-11-29-12-10-25)23-16-6-4-3-5-15(16)22-19/h3-8,13H,9-12H2,1-2H3,(H,24,26) |
| InChIKey | SSMXGEPCIROKGB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |