C21H21ClFN3O4 — CID 163326553
ethyl 5-[(4-cyano-2-fluorobenzoyl)amino]-2-morpholin-4-ylbenzoate;hydrochloride (PubChem CID 163326553) has the molecular formula C21H21ClFN3O4 and a molecular weight of 433.87 g/mol. Its IUPAC name is ethyl 5-[(4-cyano-2-fluorobenzoyl)amino]-2-morpholin-4-ylbenzoate;hydrochloride.
| Compound Name | ethyl 5-[(4-cyano-2-fluorobenzoyl)amino]-2-morpholin-4-ylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 163326553 |
| Molecular Formula | C21H21ClFN3O4 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | ethyl 5-[(4-cyano-2-fluorobenzoyl)amino]-2-morpholin-4-ylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccc(C#N)cc2F)ccc1N1CCOCC1.Cl |
| InChI | InChI=1S/C21H20FN3O4.ClH/c1-2-29-21(27)17-12-15(4-6-19(17)25-7-9-28-10-8-25)24-20(26)16-5-3-14(13-23)11-18(16)22;/h3-6,11-12H,2,7-10H2,1H3,(H,24,26);1H |
| InChIKey | ABTLQWMGAXLHEQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|