C19H22N2O4 — CID 90117734
methyl 2-hydroxy-5-[(4-morpholin-4-ylphenyl)methylamino]benzoate (PubChem CID 90117734) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl 2-hydroxy-5-[(4-morpholin-4-ylphenyl)methylamino]benzoate.
| Compound Name | methyl 2-hydroxy-5-[(4-morpholin-4-ylphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 90117734 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl 2-hydroxy-5-[(4-morpholin-4-ylphenyl)methylamino]benzoate |
| SMILES | COC(=O)c1cc(NCc2ccc(N3CCOCC3)cc2)ccc1O |
| InChI | InChI=1S/C19H22N2O4/c1-24-19(23)17-12-15(4-7-18(17)22)20-13-14-2-5-16(6-3-14)21-8-10-25-11-9-21/h2-7,12,20,22H,8-11,13H2,1H3 |
| InChIKey | RWNUGESXKGTXNF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|