C16H14BrNO4 — CID 50885110
5-[(5-bromo-2-ethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid (PubChem CID 50885110) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is 5-[(5-bromo-2-ethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(5-bromo-2-ethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 50885110 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5-[(5-bromo-2-ethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid |
| SMILES | CCOc1ccc(Br)cc1/C=N/c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H14BrNO4/c1-2-22-15-6-3-11(17)7-10(15)9-18-12-4-5-14(19)13(8-12)16(20)21/h3-9,19H,2H2,1H3,(H,20,21)/b18-9+ |
| InChIKey | PTWINAMUNXFNPL-GIJQJNRQSA-N |
| XLogP | 4.00 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|