C16H13NO6 — CID 126114890
2-hydroxy-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid (PubChem CID 126114890) has the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. Its IUPAC name is 2-hydroxy-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 126114890 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-hydroxy-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylideneamino]benzoic acid |
| SMILES | COc1cc2c(cc1/C=N/c1ccc(O)c(C(=O)O)c1)OCO2 |
| InChI | InChI=1S/C16H13NO6/c1-21-13-6-15-14(22-8-23-15)4-9(13)7-17-10-2-3-12(18)11(5-10)16(19)20/h2-7,18H,8H2,1H3,(H,19,20)/b17-7+ |
| InChIKey | VGKDHUOPRUZNPD-REZTVBANSA-N |
| XLogP | 2.58 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|