C16H14BrNO5 — CID 50885112
5-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid (PubChem CID 50885112) has the molecular formula C16H14BrNO5 and a molecular weight of 380.19 g/mol. Its IUPAC name is 5-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 50885112 |
| Molecular Formula | C16H14BrNO5 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 5-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzoic acid |
| SMILES | COc1cc(/C=N/c2ccc(O)c(C(=O)O)c2)cc(Br)c1OC |
| InChI | InChI=1S/C16H14BrNO5/c1-22-14-6-9(5-12(17)15(14)23-2)8-18-10-3-4-13(19)11(7-10)16(20)21/h3-8,19H,1-2H3,(H,20,21)/b18-8+ |
| InChIKey | ISEAUPAZCPFPKL-QGMBQPNBSA-N |
| XLogP | 3.62 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|