C23H18BrNO4 — CID 164824176
[2-bromo-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] 3-phenylprop-2-enoate (PubChem CID 164824176) has the molecular formula C23H18BrNO4 and a molecular weight of 452.30 g/mol. Its IUPAC name is [2-bromo-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] 3-phenylprop-2-enoate.
| Compound Name | [2-bromo-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 164824176 |
| Molecular Formula | C23H18BrNO4 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | [2-bromo-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] 3-phenylprop-2-enoate |
| SMILES | COc1cc(/C=N/c2ccc(O)cc2)cc(Br)c1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C23H18BrNO4/c1-28-21-14-17(15-25-18-8-10-19(26)11-9-18)13-20(24)23(21)29-22(27)12-7-16-5-3-2-4-6-16/h2-15,26H,1H3/b12-7?,25-15+ |
| InChIKey | UQUSYCOKNBXGSE-CUEKMFHUSA-N |
| XLogP | 5.53 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|