C24H17BrClNO5 — CID 164824115
4-[[4-[(E)-3-(4-bromophenyl)prop-2-enoyl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]benzoic acid (PubChem CID 164824115) has the molecular formula C24H17BrClNO5 and a molecular weight of 514.76 g/mol. Its IUPAC name is 4-[[4-[(E)-3-(4-bromophenyl)prop-2-enoyl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]benzoic acid.
| Compound Name | 4-[[4-[(E)-3-(4-bromophenyl)prop-2-enoyl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 164824115 |
| Molecular Formula | C24H17BrClNO5 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | 4-[[4-[(E)-3-(4-bromophenyl)prop-2-enoyl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]benzoic acid |
| SMILES | COc1cc(/C=N/c2ccc(C(=O)O)cc2)cc(Cl)c1OC(=O)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H17BrClNO5/c1-31-21-13-16(14-27-19-9-5-17(6-10-19)24(29)30)12-20(26)23(21)32-22(28)11-4-15-2-7-18(25)8-3-15/h2-14H,1H3,(H,29,30)/b11-4+,27-14+ |
| InChIKey | RIRMHXWIOGDTTD-NXYHMFNQSA-N |
| XLogP | 6.18 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|