C23H17BrClNO4 — CID 164824240
[2-chloro-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 164824240) has the molecular formula C23H17BrClNO4 and a molecular weight of 486.75 g/mol. Its IUPAC name is [2-chloro-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-chloro-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 164824240 |
| Molecular Formula | C23H17BrClNO4 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | [2-chloro-4-[(4-hydroxyphenyl)iminomethyl]-6-methoxyphenyl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | COc1cc(/C=N/c2ccc(O)cc2)cc(Cl)c1OC(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C23H17BrClNO4/c1-29-21-13-16(14-26-18-6-8-19(27)9-7-18)12-20(25)23(21)30-22(28)10-5-15-3-2-4-17(24)11-15/h2-14,27H,1H3/b10-5+,26-14+ |
| InChIKey | ADRFHLZGYRXFAL-KGHPOOFNSA-N |
| XLogP | 6.19 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|