C23H16BrNO4 — CID 164824130
4-[[4-[(E)-3-(3-bromophenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid (PubChem CID 164824130) has the molecular formula C23H16BrNO4 and a molecular weight of 450.29 g/mol. Its IUPAC name is 4-[[4-[(E)-3-(3-bromophenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid.
| Compound Name | 4-[[4-[(E)-3-(3-bromophenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 164824130 |
| Molecular Formula | C23H16BrNO4 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 4-[[4-[(E)-3-(3-bromophenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid |
| SMILES | O=C(/C=C/c1cccc(Br)c1)Oc1ccc(/C=N/c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H16BrNO4/c24-19-3-1-2-16(14-19)6-13-22(26)29-21-11-4-17(5-12-21)15-25-20-9-7-18(8-10-20)23(27)28/h1-15H,(H,27,28)/b13-6+,25-15+ |
| InChIKey | GMSWLJCVWFQIKY-ZDXYVKDXSA-N |
| XLogP | 5.52 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|