C24H19NO5 — CID 164824152
4-[[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid (PubChem CID 164824152) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid.
| Compound Name | 4-[[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 164824152 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-[[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxyphenyl]methylideneamino]benzoic acid |
| SMILES | COc1cccc(/C=C/C(=O)Oc2ccc(/C=N/c3ccc(C(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C24H19NO5/c1-29-22-4-2-3-17(15-22)7-14-23(26)30-21-12-5-18(6-13-21)16-25-20-10-8-19(9-11-20)24(27)28/h2-16H,1H3,(H,27,28)/b14-7+,25-16+ |
| InChIKey | FGSQJYMDZJTBHI-LGONCRSXSA-N |
| XLogP | 4.76 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|