C22H16N2O4 — CID 3419658
4-[[4-[(4-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid (PubChem CID 3419658) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-[[4-[(4-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid.
| Compound Name | 4-[[4-[(4-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 3419658 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-[[4-[(4-carboxyphenyl)iminomethyl]phenyl]methylideneamino]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=C/c2ccc(/C=N/c3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H16N2O4/c25-21(26)17-5-9-19(10-6-17)23-13-15-1-2-16(4-3-15)14-24-20-11-7-18(8-12-20)22(27)28/h1-14H,(H,25,26)(H,27,28)/b23-13+,24-14+ |
| InChIKey | IWDAJIGSYCLHBO-RNIAWFEPSA-N |
| XLogP | 4.58 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|