C43H31N3O6 — CID 122371002
4-[[4-[bis[4-[(4-carboxyphenyl)methylideneamino]phenyl]methyl]phenyl]iminomethyl]benzoic acid (PubChem CID 122371002) has the molecular formula C43H31N3O6 and a molecular weight of 685.74 g/mol. Its IUPAC name is 4-[[4-[bis[4-[(4-carboxyphenyl)methylideneamino]phenyl]methyl]phenyl]iminomethyl]benzoic acid.
| Compound Name | 4-[[4-[bis[4-[(4-carboxyphenyl)methylideneamino]phenyl]methyl]phenyl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 122371002 |
| Molecular Formula | C43H31N3O6 |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 685.22 |
| IUPAC Name | 4-[[4-[bis[4-[(4-carboxyphenyl)methylideneamino]phenyl]methyl]phenyl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N/c2ccc(C(c3ccc(/N=C/c4ccc(C(=O)O)cc4)cc3)c3ccc(/N=C/c4ccc(C(=O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H31N3O6/c47-41(48)34-7-1-28(2-8-34)25-44-37-19-13-31(14-20-37)40(32-15-21-38(22-16-32)45-26-29-3-9-35(10-4-29)42(49)50)33-17-23-39(24-18-33)46-27-30-5-11-36(12-6-30)43(51)52/h1-27,40H,(H,47,48)(H,49,50)(H,51,52)/b44-25+,45-26+,46-27+ |
| InChIKey | HHEWTRYSODNOAT-ZZTBTFBFSA-N |
| XLogP | 9.21 |
| TPSA | 148.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|