C25H26N2O4 — CID 102014245
4-[6-[4-(pyridin-4-ylmethylideneamino)phenoxy]hexoxy]benzoic acid (PubChem CID 102014245) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-[6-[4-(pyridin-4-ylmethylideneamino)phenoxy]hexoxy]benzoic acid.
| Compound Name | 4-[6-[4-(pyridin-4-ylmethylideneamino)phenoxy]hexoxy]benzoic acid |
|---|---|
| PubChem CID | 102014245 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-[6-[4-(pyridin-4-ylmethylideneamino)phenoxy]hexoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCCCCOc2ccc(/N=C/c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c28-25(29)21-5-9-23(10-6-21)30-17-3-1-2-4-18-31-24-11-7-22(8-12-24)27-19-20-13-15-26-16-14-20/h5-16,19H,1-4,17-18H2,(H,28,29)/b27-19+ |
| InChIKey | IFAYTNNRSUHEFK-ZXVVBBHZSA-N |
| XLogP | 5.55 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|