C26H28N2O3 — CID 101101759
[4-[(4-heptoxyphenyl)methylideneamino]phenyl] pyridine-3-carboxylate (PubChem CID 101101759) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is [4-[(4-heptoxyphenyl)methylideneamino]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[(4-heptoxyphenyl)methylideneamino]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101101759 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [4-[(4-heptoxyphenyl)methylideneamino]phenyl] pyridine-3-carboxylate |
| SMILES | CCCCCCCOc1ccc(/C=N/c2ccc(OC(=O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-2-3-4-5-6-18-30-24-13-9-21(10-14-24)19-28-23-11-15-25(16-12-23)31-26(29)22-8-7-17-27-20-22/h7-17,19-20H,2-6,18H2,1H3/b28-19+ |
| InChIKey | DUEZLSRFWFZBCW-TURZUDJPSA-N |
| XLogP | 6.40 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|