C23H22N2O3 — CID 101101767
[4-(pyridin-3-yliminomethyl)phenyl] 4-butoxybenzoate (PubChem CID 101101767) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is [4-(pyridin-3-yliminomethyl)phenyl] 4-butoxybenzoate.
| Compound Name | [4-(pyridin-3-yliminomethyl)phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 101101767 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [4-(pyridin-3-yliminomethyl)phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/C=N/c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-2-3-15-27-21-12-8-19(9-13-21)23(26)28-22-10-6-18(7-11-22)16-25-20-5-4-14-24-17-20/h4-14,16-17H,2-3,15H2,1H3/b25-16+ |
| InChIKey | VKQUFVSHOGMXSY-PCLIKHOPSA-N |
| XLogP | 5.23 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|