C22H20N2O4 — CID 136828288
[3-hydroxy-4-(pyridin-3-yliminomethyl)phenyl] 4-propoxybenzoate (PubChem CID 136828288) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is [3-hydroxy-4-(pyridin-3-yliminomethyl)phenyl] 4-propoxybenzoate.
| Compound Name | [3-hydroxy-4-(pyridin-3-yliminomethyl)phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 136828288 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [3-hydroxy-4-(pyridin-3-yliminomethyl)phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N/c3cccnc3)c(O)c2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-2-12-27-19-8-5-16(6-9-19)22(26)28-20-10-7-17(21(25)13-20)14-24-18-4-3-11-23-15-18/h3-11,13-15,25H,2,12H2,1H3/b24-14+ |
| InChIKey | PTNFOPFVVNNDPT-ZVHZXABRSA-N |
| XLogP | 4.55 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|