C24H22N2O2 — CID 94831942
4-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]iminomethyl]benzoic acid (PubChem CID 94831942) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]iminomethyl]benzoic acid.
| Compound Name | 4-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 94831942 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[[4-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)phenyl]iminomethyl]benzoic acid |
| SMILES | Cc1cc2c(cc1C)CN(c1ccc(/N=C/c3ccc(C(=O)O)cc3)cc1)C2 |
| InChI | InChI=1S/C24H22N2O2/c1-16-11-20-14-26(15-21(20)12-17(16)2)23-9-7-22(8-10-23)25-13-18-3-5-19(6-4-18)24(27)28/h3-13H,14-15H2,1-2H3,(H,27,28)/b25-13+ |
| InChIKey | JKCWZLHSYXYWJV-DHRITJCHSA-N |
| XLogP | 5.27 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|