C21H17BrN2 — CID 94831928
1-(4-bromophenyl)-N-[4-(1,3-dihydroisoindol-2-yl)phenyl]methanimine (PubChem CID 94831928) has the molecular formula C21H17BrN2 and a molecular weight of 377.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[4-(1,3-dihydroisoindol-2-yl)phenyl]methanimine.
| Compound Name | 1-(4-bromophenyl)-N-[4-(1,3-dihydroisoindol-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 94831928 |
| Molecular Formula | C21H17BrN2 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-(4-bromophenyl)-N-[4-(1,3-dihydroisoindol-2-yl)phenyl]methanimine |
| SMILES | Brc1ccc(/C=N/c2ccc(N3Cc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C21H17BrN2/c22-19-7-5-16(6-8-19)13-23-20-9-11-21(12-10-20)24-14-17-3-1-2-4-18(17)15-24/h1-13H,14-15H2/b23-13+ |
| InChIKey | SSKUJZQNGKAZCK-YDZHTSKRSA-N |
| XLogP | 5.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|