C23H18BrN3O3 — CID 124525519
4-[(E)-[[2-(4-bromophenyl)-1,3-dihydroisoindole-5-carbonyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 124525519) has the molecular formula C23H18BrN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is 4-[(E)-[[2-(4-bromophenyl)-1,3-dihydroisoindole-5-carbonyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[[2-(4-bromophenyl)-1,3-dihydroisoindole-5-carbonyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 124525519 |
| Molecular Formula | C23H18BrN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 4-[(E)-[[2-(4-bromophenyl)-1,3-dihydroisoindole-5-carbonyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N/NC(=O)c2ccc3c(c2)CN(c2ccc(Br)cc2)C3)cc1 |
| InChI | InChI=1S/C23H18BrN3O3/c24-20-7-9-21(10-8-20)27-13-18-6-5-17(11-19(18)14-27)22(28)26-25-12-15-1-3-16(4-2-15)23(29)30/h1-12H,13-14H2,(H,26,28)(H,29,30)/b25-12+ |
| InChIKey | VIBLJCMRWHPCAV-BRJLIKDPSA-N |
| XLogP | 4.43 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|