C22H18FN3O2 — CID 137059943
2-(4-fluorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dihydroisoindole-5-carboxamide (PubChem CID 137059943) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dihydroisoindole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 137059943 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dihydroisoindole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1ccc2c(c1)CN(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C22H18FN3O2/c23-19-7-9-20(10-8-19)26-13-17-6-5-15(11-18(17)14-26)22(28)25-24-12-16-3-1-2-4-21(16)27/h1-12,27H,13-14H2,(H,25,28)/b24-12+ |
| InChIKey | MRZLOGBWWTZUAA-WYMPLXKRSA-N |
| XLogP | 3.82 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|