C18H18O5 — CID 71323634
(3,4,5-trimethoxyphenyl) 3-phenylprop-2-enoate (PubChem CID 71323634) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 3-phenylprop-2-enoate.
| Compound Name | (3,4,5-trimethoxyphenyl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 71323634 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 3-phenylprop-2-enoate |
| SMILES | COc1cc(OC(=O)C=Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18O5/c1-20-15-11-14(12-16(21-2)18(15)22-3)23-17(19)10-9-13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChIKey | HHCCWBRQPBEBBS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|