C20H20O5 — CID 46834834
[4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxyphenyl] (E)-3-phenylprop-2-enoate (PubChem CID 46834834) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is [4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxyphenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxyphenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 46834834 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [4-[(E)-3-hydroxyprop-1-enyl]-2,6-dimethoxyphenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(/C=C/CO)cc(OC)c1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H20O5/c1-23-17-13-16(9-6-12-21)14-18(24-2)20(17)25-19(22)11-10-15-7-4-3-5-8-15/h3-11,13-14,21H,12H2,1-2H3/b9-6+,11-10+ |
| InChIKey | JCYOWNRHTAWRSF-GOKBKIRCSA-N |
| XLogP | 3.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|