C19H17NO5 — CID 7934976
(2-cyanophenyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 7934976) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (2-cyanophenyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-cyanophenyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7934976 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2-cyanophenyl) (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccccc2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C19H17NO5/c1-22-16-10-13(11-17(23-2)19(16)24-3)8-9-18(21)25-15-7-5-4-6-14(15)12-20/h4-11H,1-3H3/b9-8+ |
| InChIKey | ZWWZPSKOVZKWAE-CMDGGOBGSA-N |
| XLogP | 3.20 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|