C18H18O5 — CID 26688230
(2-methoxyphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 26688230) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2-methoxyphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-methoxyphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 26688230 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2-methoxyphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccccc2OC)cc(OC)c1 |
| InChI | InChI=1S/C18H18O5/c1-20-14-10-13(11-15(12-14)21-2)8-9-18(19)23-17-7-5-4-6-16(17)22-3/h4-12H,1-3H3/b9-8+ |
| InChIKey | HGCYWUAGJXWKFA-CMDGGOBGSA-N |
| XLogP | 3.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|