C17H15NO6 — CID 43013492
(4-nitrophenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 43013492) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is (4-nitrophenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-nitrophenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 43013492 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (4-nitrophenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc([N+](=O)[O-])cc2)cc(OC)c1 |
| InChI | InChI=1S/C17H15NO6/c1-22-15-9-12(10-16(11-15)23-2)3-8-17(19)24-14-6-4-13(5-7-14)18(20)21/h3-11H,1-2H3/b8-3+ |
| InChIKey | ULTWHGUYWWHUCM-FPYGCLRLSA-N |
| XLogP | 3.23 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|