C19H19NO6 — CID 8665564
[(1S)-1-(3-nitrophenyl)ethyl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 8665564) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is [(1S)-1-(3-nitrophenyl)ethyl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1S)-1-(3-nitrophenyl)ethyl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8665564 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(1S)-1-(3-nitrophenyl)ethyl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)c2cccc([N+](=O)[O-])c2)cc(OC)c1 |
| InChI | InChI=1S/C19H19NO6/c1-13(15-5-4-6-16(11-15)20(22)23)26-19(21)8-7-14-9-17(24-2)12-18(10-14)25-3/h4-13H,1-3H3/b8-7+/t13-/m0/s1 |
| InChIKey | BIPOWLZVTNRJAQ-GWJCSSMESA-N |
| XLogP | 3.93 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|