C20H20O5 — CID 26691631
(4-propanoylphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 26691631) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (4-propanoylphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-propanoylphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 26691631 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (4-propanoylphenyl) (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCC(=O)c1ccc(OC(=O)/C=C/c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C20H20O5/c1-4-19(21)15-6-8-16(9-7-15)25-20(22)10-5-14-11-17(23-2)13-18(12-14)24-3/h5-13H,4H2,1-3H3/b10-5+ |
| InChIKey | QCENMOBGYAWNRO-BJMVGYQFSA-N |
| XLogP | 3.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|