C22H24O6 — CID 8665379
[(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 8665379) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is [(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8665379 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(2S)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C(=O)[C@H](C)OC(=O)/C=C/c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C22H24O6/c1-5-27-18-9-7-17(8-10-18)22(24)15(2)28-21(23)11-6-16-12-19(25-3)14-20(13-16)26-4/h6-15H,5H2,1-4H3/b11-6+/t15-/m0/s1 |
| InChIKey | CXVASKGANKVPGJ-VQCVXAJWSA-N |
| XLogP | 3.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|