C19H17F3O5 — CID 76855200
[2-(trifluoromethyl)phenyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 76855200) has the molecular formula C19H17F3O5 and a molecular weight of 382.33 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(trifluoromethyl)phenyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 76855200 |
| Molecular Formula | C19H17F3O5 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-(trifluoromethyl)phenyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)Oc2ccccc2C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C19H17F3O5/c1-24-15-10-12(11-16(25-2)18(15)26-3)8-9-17(23)27-14-7-5-4-6-13(14)19(20,21)22/h4-11H,1-3H3 |
| InChIKey | AGGVWZRYWQLGTO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|