C22H26FNO5 — CID 90599191
(E)-N-[2-(2-fluorophenyl)-2-methoxypropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 90599191) has the molecular formula C22H26FNO5 and a molecular weight of 403.45 g/mol. Its IUPAC name is (E)-N-[2-(2-fluorophenyl)-2-methoxypropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-fluorophenyl)-2-methoxypropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90599191 |
| Molecular Formula | C22H26FNO5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (E)-N-[2-(2-fluorophenyl)-2-methoxypropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(C)(OC)c2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C22H26FNO5/c1-22(29-5,16-8-6-7-9-17(16)23)14-24-20(25)11-10-15-12-18(26-2)21(28-4)19(13-15)27-3/h6-13H,14H2,1-5H3,(H,24,25)/b11-10+ |
| InChIKey | QMPHHPBQNDMFBU-ZHACJKMWSA-N |
| XLogP | 3.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|