C22H26BrNO4 — CID 52611554
(E)-N-[2-(4-bromophenyl)-2-methylpropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 52611554) has the molecular formula C22H26BrNO4 and a molecular weight of 448.36 g/mol. Its IUPAC name is (E)-N-[2-(4-bromophenyl)-2-methylpropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromophenyl)-2-methylpropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 52611554 |
| Molecular Formula | C22H26BrNO4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (E)-N-[2-(4-bromophenyl)-2-methylpropyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(C)(C)c2ccc(Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26BrNO4/c1-22(2,16-7-9-17(23)10-8-16)14-24-20(25)11-6-15-12-18(26-3)21(28-5)19(13-15)27-4/h6-13H,14H2,1-5H3,(H,24,25)/b11-6+ |
| InChIKey | ILAMOXBHLBMMLZ-IZZDOVSWSA-N |
| XLogP | 4.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|