C16H23NO7 — CID 24891432
(E)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 24891432) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is (E)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24891432 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (E)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC(CO)(CO)CO)cc(OC)c1OC |
| InChI | InChI=1S/C16H23NO7/c1-22-12-6-11(7-13(23-2)15(12)24-3)4-5-14(21)17-16(8-18,9-19)10-20/h4-7,18-20H,8-10H2,1-3H3,(H,17,21)/b5-4+ |
| InChIKey | UZLFOWSTHQLHTM-SNAWJCMRSA-N |
| XLogP | -0.44 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|