C19H29N3O4S — CID 139462760
(E)-N-[2-(methylcarbamothioylamino)pentan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 139462760) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is (E)-N-[2-(methylcarbamothioylamino)pentan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(methylcarbamothioylamino)pentan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 139462760 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (E)-N-[2-(methylcarbamothioylamino)pentan-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | CCCC(C)(NC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1)NC(=S)NC |
| InChI | InChI=1S/C19H29N3O4S/c1-7-10-19(2,22-18(27)20-3)21-16(23)9-8-13-11-14(24-4)17(26-6)15(12-13)25-5/h8-9,11-12H,7,10H2,1-6H3,(H,21,23)(H2,20,22,27)/b9-8+ |
| InChIKey | YUKQHVUFSZIJER-CMDGGOBGSA-N |
| XLogP | 2.45 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|