C16H19NO4 — CID 90537887
(E)-N-but-3-ynyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 90537887) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (E)-N-but-3-ynyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-but-3-ynyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90537887 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (E)-N-but-3-ynyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | C#CCCNC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H19NO4/c1-5-6-9-17-15(18)8-7-12-10-13(19-2)16(21-4)14(11-12)20-3/h1,7-8,10-11H,6,9H2,2-4H3,(H,17,18)/b8-7+ |
| InChIKey | KSOPMSGLSPRRQO-BQYQJAHWSA-N |
| XLogP | 1.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|