C27H33NO9 — CID 6020428
1-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propan-2-yl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 6020428) has the molecular formula C27H33NO9 and a molecular weight of 515.56 g/mol. Its IUPAC name is 1-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propan-2-yl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | 1-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propan-2-yl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6020428 |
| Molecular Formula | C27H33NO9 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 1-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propan-2-yl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)NCC(C)OC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H33NO9/c1-17(37-25(30)11-9-19-14-22(33-4)27(36-7)23(15-19)34-5)16-28-24(29)10-8-18-12-20(31-2)26(35-6)21(13-18)32-3/h8-15,17H,16H2,1-7H3,(H,28,29)/b10-8+,11-9+ |
| InChIKey | DYQMYRBYQRDVLF-GFULKKFKSA-N |
| XLogP | 3.51 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|