C29H29NO6 — CID 138523251
[(1S)-2-[[(E)-3-phenylprop-2-enoyl]amino]-1-(3,4,5-trimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 138523251) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is [(1S)-2-[[(E)-3-phenylprop-2-enoyl]amino]-1-(3,4,5-trimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S)-2-[[(E)-3-phenylprop-2-enoyl]amino]-1-(3,4,5-trimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 138523251 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [(1S)-2-[[(E)-3-phenylprop-2-enoyl]amino]-1-(3,4,5-trimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc([C@@H](CNC(=O)/C=C/c2ccccc2)OC(=O)/C=C/c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H29NO6/c1-33-24-18-23(19-25(34-2)29(24)35-3)26(36-28(32)17-15-22-12-8-5-9-13-22)20-30-27(31)16-14-21-10-6-4-7-11-21/h4-19,26H,20H2,1-3H3,(H,30,31)/b16-14+,17-15+/t26-/m1/s1 |
| InChIKey | NHOMJMAJLKYBFK-NFWBPRKJSA-N |
| XLogP | 4.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|