C23H27NO5 — CID 155112234
[2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 155112234) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 155112234 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | CCCC(=O)NCC(OC(=O)/C=C/c1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H27NO5/c1-4-8-22(25)24-16-21(18-12-13-19(27-2)20(15-18)28-3)29-23(26)14-11-17-9-6-5-7-10-17/h5-7,9-15,21H,4,8,16H2,1-3H3,(H,24,25)/b14-11+ |
| InChIKey | MCPTXEOEQFDQIO-SDNWHVSQSA-N |
| XLogP | 3.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|