C27H24O5 — CID 130362732
[(2S)-2-(4-methoxyphenyl)-2-(3-phenylprop-2-enoyloxy)ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 130362732) has the molecular formula C27H24O5 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(2S)-2-(4-methoxyphenyl)-2-(3-phenylprop-2-enoyloxy)ethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2S)-2-(4-methoxyphenyl)-2-(3-phenylprop-2-enoyloxy)ethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 130362732 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(2S)-2-(4-methoxyphenyl)-2-(3-phenylprop-2-enoyloxy)ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1ccc([C@@H](COC(=O)/C=C/c2ccccc2)OC(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H24O5/c1-30-24-16-14-23(15-17-24)25(32-27(29)19-13-22-10-6-3-7-11-22)20-31-26(28)18-12-21-8-4-2-5-9-21/h2-19,25H,20H2,1H3/b18-12+,19-13?/t25-/m1/s1 |
| InChIKey | PAIOCWLROKMFPJ-NGEGUCPFSA-N |
| XLogP | 5.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|