C27H22O6 — CID 138534638
[(2S)-2-(1,3-benzodioxol-5-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate (PubChem CID 138534638) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is [(2S)-2-(1,3-benzodioxol-5-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2S)-2-(1,3-benzodioxol-5-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 138534638 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [(2S)-2-(1,3-benzodioxol-5-yl)-2-[(E)-3-phenylprop-2-enoyl]oxyethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC[C@@H](OC(=O)/C=C/c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H22O6/c28-26(15-11-20-7-3-1-4-8-20)30-18-25(22-13-14-23-24(17-22)32-19-31-23)33-27(29)16-12-21-9-5-2-6-10-21/h1-17,25H,18-19H2/b15-11+,16-12+/t25-/m1/s1 |
| InChIKey | GPKLGTIXBIYSGN-HCRCVSHZSA-N |
| XLogP | 4.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|